C11H16N2O4S — CID 63114506
2-[[3-methoxypropyl(methyl)carbamoyl]amino]thiophene-3-carboxylic acid (PubChem CID 63114506) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[[3-methoxypropyl(methyl)carbamoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[3-methoxypropyl(methyl)carbamoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114506 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[[3-methoxypropyl(methyl)carbamoyl]amino]thiophene-3-carboxylic acid |
| SMILES | COCCCN(C)C(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C11H16N2O4S/c1-13(5-3-6-17-2)11(16)12-9-8(10(14)15)4-7-18-9/h4,7H,3,5-6H2,1-2H3,(H,12,16)(H,14,15) |
| InChIKey | GOWUUTISNOPNHS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|