C12H21NO4 — CID 103551207
3-(1-hydroxypentan-3-ylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 103551207) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-(1-hydroxypentan-3-ylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(1-hydroxypentan-3-ylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103551207 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-(1-hydroxypentan-3-ylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCC(CCO)NC(=O)C1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C12H21NO4/c1-2-10(5-6-14)13-11(15)8-3-4-9(7-8)12(16)17/h8-10,14H,2-7H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | PYPPDLRLKZLGPS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |