C11H21NO4S — CID 113428473
N-(1-hydroxypentan-3-yl)-1,1-dioxothiane-2-carboxamide (PubChem CID 113428473) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(1-hydroxypentan-3-yl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(1-hydroxypentan-3-yl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 113428473 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-(1-hydroxypentan-3-yl)-1,1-dioxothiane-2-carboxamide |
| SMILES | CCC(CCO)NC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H21NO4S/c1-2-9(6-7-13)12-11(14)10-5-3-4-8-17(10,15)16/h9-10,13H,2-8H2,1H3,(H,12,14) |
| InChIKey | IFLOIKFUPXRLPE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |