C12H20ClFN4 — CID 103552862
5-chloro-1-N-[4-(dimethylamino)butan-2-yl]-6-fluorobenzene-1,2,4-triamine (PubChem CID 103552862) has the molecular formula C12H20ClFN4 and a molecular weight of 274.77 g/mol. Its IUPAC name is 5-chloro-1-N-[4-(dimethylamino)butan-2-yl]-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-[4-(dimethylamino)butan-2-yl]-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103552862 |
| Molecular Formula | C12H20ClFN4 |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-chloro-1-N-[4-(dimethylamino)butan-2-yl]-6-fluorobenzene-1,2,4-triamine |
| SMILES | CC(CCN(C)C)Nc1c(N)cc(N)c(Cl)c1F |
| InChI | InChI=1S/C12H20ClFN4/c1-7(4-5-18(2)3)17-12-9(16)6-8(15)10(13)11(12)14/h6-7,17H,4-5,15-16H2,1-3H3 |
| InChIKey | QWFMZLLBEUQNCE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|