C12H17ClFN3O — CID 103553739
4-chloro-5-fluoro-6-(2-pyrrolidin-1-ylethoxy)benzene-1,3-diamine (PubChem CID 103553739) has the molecular formula C12H17ClFN3O and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-chloro-5-fluoro-6-(2-pyrrolidin-1-ylethoxy)benzene-1,3-diamine.
| Compound Name | 4-chloro-5-fluoro-6-(2-pyrrolidin-1-ylethoxy)benzene-1,3-diamine |
|---|---|
| PubChem CID | 103553739 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-chloro-5-fluoro-6-(2-pyrrolidin-1-ylethoxy)benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(OCCN2CCCC2)c(F)c1Cl |
| InChI | InChI=1S/C12H17ClFN3O/c13-10-8(15)7-9(16)12(11(10)14)18-6-5-17-3-1-2-4-17/h7H,1-6,15-16H2 |
| InChIKey | JZQWIDMSDTWSPA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|