C15H26O2Si — CID 10355588
[(E)-(8,8-dimethyl-2-methylidene-7,9-dioxaspiro[4.5]decan-3-ylidene)methyl]-trimethylsilane (PubChem CID 10355588) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is [(E)-(8,8-dimethyl-2-methylidene-7,9-dioxaspiro[4.5]decan-3-ylidene)methyl]-trimethylsilane.
| Compound Name | [(E)-(8,8-dimethyl-2-methylidene-7,9-dioxaspiro[4.5]decan-3-ylidene)methyl]-trimethylsilane |
|---|---|
| PubChem CID | 10355588 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [(E)-(8,8-dimethyl-2-methylidene-7,9-dioxaspiro[4.5]decan-3-ylidene)methyl]-trimethylsilane |
| SMILES | C=C1CC2(COC(C)(C)OC2)C/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C15H26O2Si/c1-12-7-15(8-13(12)9-18(4,5)6)10-16-14(2,3)17-11-15/h9H,1,7-8,10-11H2,2-6H3/b13-9+ |
| InChIKey | FTJVMIMAIBTTQZ-UKTHLTGXSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|