C27H54O2SiSn — CID 164687056
[(Z)-[8,8-dimethyl-2-(tributylstannylmethyl)-7,9-dioxaspiro[4.5]decan-3-ylidene]methyl]-trimethylsilane (PubChem CID 164687056) has the molecular formula C27H54O2SiSn and a molecular weight of 557.52 g/mol. Its IUPAC name is [(Z)-[8,8-dimethyl-2-(tributylstannylmethyl)-7,9-dioxaspiro[4.5]decan-3-ylidene]methyl]-trimethylsilane.
| Compound Name | [(Z)-[8,8-dimethyl-2-(tributylstannylmethyl)-7,9-dioxaspiro[4.5]decan-3-ylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 164687056 |
| Molecular Formula | C27H54O2SiSn |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | [(Z)-[8,8-dimethyl-2-(tributylstannylmethyl)-7,9-dioxaspiro[4.5]decan-3-ylidene]methyl]-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC1CC2(COC(C)(C)OC2)C/C1=C/[Si](C)(C)C |
| InChI | InChI=1S/C15H27O2Si.3C4H9.Sn/c1-12-7-15(8-13(12)9-18(4,5)6)10-16-14(2,3)17-11-15;3*1-3-4-2;/h9,12H,1,7-8,10-11H2,2-6H3;3*1,3-4H2,2H3;/b13-9-;;;; |
| InChIKey | MTTIGBAXICJYNN-FEGRSWJESA-N |
| XLogP | 8.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|