C24H46O2Sn — CID 177398378
tributyl-[(8,8-dimethyl-3-methylidene-7,9-dioxaspiro[4.5]decan-2-yl)methyl]stannane (PubChem CID 177398378) has the molecular formula C24H46O2Sn and a molecular weight of 485.34 g/mol. Its IUPAC name is tributyl-[(8,8-dimethyl-3-methylidene-7,9-dioxaspiro[4.5]decan-2-yl)methyl]stannane.
| Compound Name | tributyl-[(8,8-dimethyl-3-methylidene-7,9-dioxaspiro[4.5]decan-2-yl)methyl]stannane |
|---|---|
| PubChem CID | 177398378 |
| Molecular Formula | C24H46O2Sn |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tributyl-[(8,8-dimethyl-3-methylidene-7,9-dioxaspiro[4.5]decan-2-yl)methyl]stannane |
| SMILES | C=C1CC2(COC(C)(C)OC2)CC1C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C12H19O2.3C4H9.Sn/c1-9-5-12(6-10(9)2)7-13-11(3,4)14-8-12;3*1-3-4-2;/h9H,1-2,5-8H2,3-4H3;3*1,3-4H2,2H3; |
| InChIKey | PAPCSNJKTSHJLX-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|