C14H21IO2 — CID 135041213
(3E)-3-(iodomethylidene)-8,8-dimethyl-2-prop-1-en-2-yl-7,9-dioxaspiro[4.5]decane (PubChem CID 135041213) has the molecular formula C14H21IO2 and a molecular weight of 348.22 g/mol. Its IUPAC name is (3E)-3-(iodomethylidene)-8,8-dimethyl-2-prop-1-en-2-yl-7,9-dioxaspiro[4.5]decane.
| Compound Name | (3E)-3-(iodomethylidene)-8,8-dimethyl-2-prop-1-en-2-yl-7,9-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 135041213 |
| Molecular Formula | C14H21IO2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (3E)-3-(iodomethylidene)-8,8-dimethyl-2-prop-1-en-2-yl-7,9-dioxaspiro[4.5]decane |
| SMILES | C=C(C)C1CC2(COC(C)(C)OC2)C/C1=C\I |
| InChI | InChI=1S/C14H21IO2/c1-10(2)12-6-14(5-11(12)7-15)8-16-13(3,4)17-9-14/h7,12H,1,5-6,8-9H2,2-4H3/b11-7+ |
| InChIKey | VVUKUULCTHRBIL-YRNVUSSQSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|