C19H36O2Si — CID 11771704
triethyl-[(1Z)-1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]decan-3-ylidene)ethyl]silane (PubChem CID 11771704) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is triethyl-[(1Z)-1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]decan-3-ylidene)ethyl]silane.
| Compound Name | triethyl-[(1Z)-1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]decan-3-ylidene)ethyl]silane |
|---|---|
| PubChem CID | 11771704 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | triethyl-[(1Z)-1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]decan-3-ylidene)ethyl]silane |
| SMILES | CC[Si](CC)(CC)/C(C)=C1/CC2(COC(C)(C)OC2)CC1C |
| InChI | InChI=1S/C19H36O2Si/c1-8-22(9-2,10-3)16(5)17-12-19(11-15(17)4)13-20-18(6,7)21-14-19/h15H,8-14H2,1-7H3/b17-16- |
| InChIKey | PNNMMJLQQIDWNO-MSUUIHNZSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|