C18H36O2Si — CID 101229219
[(1Z)-1-[4,4-bis(methoxymethyl)-2-methylcyclopentylidene]ethyl]-triethylsilane (PubChem CID 101229219) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is [(1Z)-1-[4,4-bis(methoxymethyl)-2-methylcyclopentylidene]ethyl]-triethylsilane.
| Compound Name | [(1Z)-1-[4,4-bis(methoxymethyl)-2-methylcyclopentylidene]ethyl]-triethylsilane |
|---|---|
| PubChem CID | 101229219 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | [(1Z)-1-[4,4-bis(methoxymethyl)-2-methylcyclopentylidene]ethyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)/C(C)=C1/CC(COC)(COC)CC1C |
| InChI | InChI=1S/C18H36O2Si/c1-8-21(9-2,10-3)16(5)17-12-18(13-19-6,14-20-7)11-15(17)4/h15H,8-14H2,1-7H3/b17-16- |
| InChIKey | BGYDRYSZTZCDOA-MSUUIHNZSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|