C20H36O4Si — CID 101229220
[(4Z)-1-(acetyloxymethyl)-3-methyl-4-(1-triethylsilylethylidene)cyclopentyl]methyl acetate (PubChem CID 101229220) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is [(4Z)-1-(acetyloxymethyl)-3-methyl-4-(1-triethylsilylethylidene)cyclopentyl]methyl acetate.
| Compound Name | [(4Z)-1-(acetyloxymethyl)-3-methyl-4-(1-triethylsilylethylidene)cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 101229220 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | [(4Z)-1-(acetyloxymethyl)-3-methyl-4-(1-triethylsilylethylidene)cyclopentyl]methyl acetate |
| SMILES | CC[Si](CC)(CC)/C(C)=C1/CC(COC(C)=O)(COC(C)=O)CC1C |
| InChI | InChI=1S/C20H36O4Si/c1-8-25(9-2,10-3)16(5)19-12-20(11-15(19)4,13-23-17(6)21)14-24-18(7)22/h15H,8-14H2,1-7H3/b19-16- |
| InChIKey | AYHQMHIUCNUYGW-MNDPQUGUSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|