C21H38O4Si — CID 177429239
dimethyl (4E)-3-methyl-4-(1-triethylsilylpentylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 177429239) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is dimethyl (4E)-3-methyl-4-(1-triethylsilylpentylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-methyl-4-(1-triethylsilylpentylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177429239 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | dimethyl (4E)-3-methyl-4-(1-triethylsilylpentylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CCCC/C(=C1/CC(C(=O)OC)(C(=O)OC)CC1C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H38O4Si/c1-8-12-13-18(26(9-2,10-3)11-4)17-15-21(14-16(17)5,19(22)24-6)20(23)25-7/h16H,8-15H2,1-7H3/b18-17+ |
| InChIKey | NKTYDJCKFPRYHK-ISLYRVAYSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|