C16H26O4Si — CID 177433137
diethyl 2,2,3-trimethyl-1,4,6,6a-tetrahydrocyclopenta[c]silole-5,5-dicarboxylate (PubChem CID 177433137) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is diethyl 2,2,3-trimethyl-1,4,6,6a-tetrahydrocyclopenta[c]silole-5,5-dicarboxylate.
| Compound Name | diethyl 2,2,3-trimethyl-1,4,6,6a-tetrahydrocyclopenta[c]silole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 177433137 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | diethyl 2,2,3-trimethyl-1,4,6,6a-tetrahydrocyclopenta[c]silole-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(C)[Si](C)(C)CC2C1 |
| InChI | InChI=1S/C16H26O4Si/c1-6-19-14(17)16(15(18)20-7-2)8-12-10-21(4,5)11(3)13(12)9-16/h12H,6-10H2,1-5H3 |
| InChIKey | BKMJMHMOUOEOKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|