C28H52O4Si — CID 101154288
[(3S,4R)-3-[(E)-but-1-enyl]-1-(2,2-dimethylpropanoyloxymethyl)-4-(triethylsilylmethyl)cyclopentyl]methyl 2,2-dimethylpropanoate (PubChem CID 101154288) has the molecular formula C28H52O4Si and a molecular weight of 480.81 g/mol. Its IUPAC name is [(3S,4R)-3-[(E)-but-1-enyl]-1-(2,2-dimethylpropanoyloxymethyl)-4-(triethylsilylmethyl)cyclopentyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3S,4R)-3-[(E)-but-1-enyl]-1-(2,2-dimethylpropanoyloxymethyl)-4-(triethylsilylmethyl)cyclopentyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101154288 |
| Molecular Formula | C28H52O4Si |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | [(3S,4R)-3-[(E)-but-1-enyl]-1-(2,2-dimethylpropanoyloxymethyl)-4-(triethylsilylmethyl)cyclopentyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC/C=C/[C@@H]1CC(COC(=O)C(C)(C)C)(COC(=O)C(C)(C)C)C[C@H]1C[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H52O4Si/c1-11-15-16-22-17-28(20-31-24(29)26(5,6)7,21-32-25(30)27(8,9)10)18-23(22)19-33(12-2,13-3)14-4/h15-16,22-23H,11-14,17-21H2,1-10H3/b16-15+/t22-,23+/m1/s1 |
| InChIKey | PHECDSONDHKKOC-OVRJOZPVSA-N |
| XLogP | 7.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|