C32H60O4SiSn — CID 10055086
trans-diethyl (3S,4S)-3-[(E)-3-tributylstannylprop-1-enyl]-4-[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 10055086) has the molecular formula C32H60O4SiSn and a molecular weight of 655.63 g/mol. Its IUPAC name is trans-diethyl (3S,4S)-3-[(E)-3-tributylstannylprop-1-enyl]-4-[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3S,4S)-3-[(E)-3-tributylstannylprop-1-enyl]-4-[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10055086 |
| Molecular Formula | C32H60O4SiSn |
| Molecular Weight | 655.63 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | trans-diethyl (3S,4S)-3-[(E)-3-tributylstannylprop-1-enyl]-4-[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCCC[Sn](C/C=C/[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@H]1/C=C/C[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C20H33O4Si.3C4H9.Sn/c1-7-11-16-14-20(18(21)23-8-2,19(22)24-9-3)15-17(16)12-10-13-25(4,5)6;3*1-3-4-2;/h7,10-12,16-17H,1,8-9,13-15H2,2-6H3;3*1,3-4H2,2H3;/b11-7+,12-10+;;;;/t16-,17-;;;;/m1..../s1 |
| InChIKey | JXKPZWFIGNMAQC-BFMXJIDXSA-N |
| XLogP | 9.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.63 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|