C23H42O4Si2 — CID 10094699
trans-diethyl (3S,4S)-3,4-bis[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 10094699) has the molecular formula C23H42O4Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is trans-diethyl (3S,4S)-3,4-bis[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3S,4S)-3,4-bis[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10094699 |
| Molecular Formula | C23H42O4Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | trans-diethyl (3S,4S)-3,4-bis[(E)-3-trimethylsilylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](/C=C/C[Si](C)(C)C)[C@H](/C=C/C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C23H42O4Si2/c1-9-26-21(24)23(22(25)27-10-2)17-19(13-11-15-28(3,4)5)20(18-23)14-12-16-29(6,7)8/h11-14,19-20H,9-10,15-18H2,1-8H3/b13-11+,14-12+/t19-,20-/m1/s1 |
| InChIKey | GDUNWZOEJTZAOK-YZKIUJHNSA-N |
| XLogP | 5.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|