C26H48O4SiSn — CID 10053771
trans-diethyl (3S,4S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 10053771) has the molecular formula C26H48O4SiSn and a molecular weight of 571.46 g/mol. Its IUPAC name is trans-diethyl (3S,4S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3S,4S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10053771 |
| Molecular Formula | C26H48O4SiSn |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | trans-diethyl (3S,4S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](/C=C/C[Si](C)(C)C(C)(C)C)[C@H](/C=C/C[Sn](C)(C)C)C1 |
| InChI | InChI=1S/C23H39O4Si.3CH3.Sn/c1-9-13-18-16-23(20(24)26-10-2,21(25)27-11-3)17-19(18)14-12-15-28(7,8)22(4,5)6;;;;/h9,12-14,18-19H,1,10-11,15-17H2,2-8H3;3*1H3;/b13-9+,14-12+;;;;/t18-,19-;;;;/m1..../s1 |
| InChIKey | OBRZNDCAICDLNU-JIQCCRSKSA-N |
| XLogP | 7.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|