C14H20O6 — CID 10356509
(4R,5R)-4-but-3-en-2-yl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxyoxolane-2,3-dione (PubChem CID 10356509) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is (4R,5R)-4-but-3-en-2-yl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxyoxolane-2,3-dione.
| Compound Name | (4R,5R)-4-but-3-en-2-yl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxyoxolane-2,3-dione |
|---|---|
| PubChem CID | 10356509 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (4R,5R)-4-but-3-en-2-yl-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxyoxolane-2,3-dione |
| SMILES | C=CC(C)[C@]1(OC)C(=O)C(=O)O[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H20O6/c1-6-8(2)14(17-5)10(15)12(16)19-11(14)9-7-18-13(3,4)20-9/h6,8-9,11H,1,7H2,2-5H3/t8?,9-,11+,14-/m0/s1 |
| InChIKey | BPKPZCHFVBPSDS-VBSWXGIISA-N |
| XLogP | 0.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|