C15H20O6 — CID 3741489
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-prop-2-enoxy-4-prop-2-enyloxolane-2,3-dione (PubChem CID 3741489) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-prop-2-enoxy-4-prop-2-enyloxolane-2,3-dione.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-prop-2-enoxy-4-prop-2-enyloxolane-2,3-dione |
|---|---|
| PubChem CID | 3741489 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-prop-2-enoxy-4-prop-2-enyloxolane-2,3-dione |
| SMILES | C=CCOC1(CC=C)C(=O)C(=O)OC1C1COC(C)(C)O1 |
| InChI | InChI=1S/C15H20O6/c1-5-7-15(18-8-6-2)11(16)13(17)20-12(15)10-9-19-14(3,4)21-10/h5-6,10,12H,1-2,7-9H2,3-4H3 |
| InChIKey | NDVPZBSZQZALOE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|