C13H18O5 — CID 46230253
(3'aR,5R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-5,5'-4,7a-dihydro-3aH-1,3-benzodioxole]-4-one (PubChem CID 46230253) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (3'aR,5R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-5,5'-4,7a-dihydro-3aH-1,3-benzodioxole]-4-one.
| Compound Name | (3'aR,5R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-5,5'-4,7a-dihydro-3aH-1,3-benzodioxole]-4-one |
|---|---|
| PubChem CID | 46230253 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (3'aR,5R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-5,5'-4,7a-dihydro-3aH-1,3-benzodioxole]-4-one |
| SMILES | CC1(C)O[C@H]2C=C[C@@]3(C[C@H]2O1)OC(C)(C)OC3=O |
| InChI | InChI=1S/C13H18O5/c1-11(2)15-8-5-6-13(7-9(8)16-11)10(14)17-12(3,4)18-13/h5-6,8-9H,7H2,1-4H3/t8-,9+,13-/m0/s1 |
| InChIKey | UXXFUUHXUAPHTG-RWEMILLDSA-N |
| XLogP | 1.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|