C10H14O5 — CID 46230254
(5R,8R,9R)-8,9-dihydroxy-2,2-dimethyl-1,3-dioxaspiro[4.5]dec-6-en-4-one (PubChem CID 46230254) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (5R,8R,9R)-8,9-dihydroxy-2,2-dimethyl-1,3-dioxaspiro[4.5]dec-6-en-4-one.
| Compound Name | (5R,8R,9R)-8,9-dihydroxy-2,2-dimethyl-1,3-dioxaspiro[4.5]dec-6-en-4-one |
|---|---|
| PubChem CID | 46230254 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (5R,8R,9R)-8,9-dihydroxy-2,2-dimethyl-1,3-dioxaspiro[4.5]dec-6-en-4-one |
| SMILES | CC1(C)OC(=O)[C@@]2(C=C[C@@H](O)[C@H](O)C2)O1 |
| InChI | InChI=1S/C10H14O5/c1-9(2)14-8(13)10(15-9)4-3-6(11)7(12)5-10/h3-4,6-7,11-12H,5H2,1-2H3/t6-,7-,10+/m1/s1 |
| InChIKey | WLPSLTGUXRKBPM-XSSZXYGBSA-N |
| XLogP | -0.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|