C11H16O4 — CID 11241311
(3aR,4R,6aR)-3a-ethenyl-4-ethyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-one (PubChem CID 11241311) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3aR,4R,6aR)-3a-ethenyl-4-ethyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-one.
| Compound Name | (3aR,4R,6aR)-3a-ethenyl-4-ethyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-one |
|---|---|
| PubChem CID | 11241311 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3aR,4R,6aR)-3a-ethenyl-4-ethyl-2,2-dimethyl-4,6a-dihydrofuro[3,4-d][1,3]dioxol-6-one |
| SMILES | C=C[C@]12OC(C)(C)O[C@H]1C(=O)O[C@@H]2CC |
| InChI | InChI=1S/C11H16O4/c1-5-7-11(6-2)8(9(12)13-7)14-10(3,4)15-11/h6-8H,2,5H2,1,3-4H3/t7-,8+,11-/m1/s1 |
| InChIKey | KGJKWSLUJDECNS-VHSKPIJISA-N |
| XLogP | 1.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|