C13H20O6 — CID 100977634
methyl (3aR,4R,6S,6aS)-6-methoxy-2,2-dimethyl-4-prop-2-enyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate (PubChem CID 100977634) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (3aR,4R,6S,6aS)-6-methoxy-2,2-dimethyl-4-prop-2-enyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate.
| Compound Name | methyl (3aR,4R,6S,6aS)-6-methoxy-2,2-dimethyl-4-prop-2-enyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 100977634 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl (3aR,4R,6S,6aS)-6-methoxy-2,2-dimethyl-4-prop-2-enyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC)O[C@H](OC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H20O6/c1-6-7-13(11(14)16-5)9-8(10(15-4)19-13)17-12(2,3)18-9/h6,8-10H,1,7H2,2-5H3/t8-,9+,10-,13+/m0/s1 |
| InChIKey | BOWXWWJJCFWRJU-MPXOCVNLSA-N |
| XLogP | 1.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|