C14H21NO2S — CID 103567292
3-(3,3-dimethylbutoxy)-5-methoxybenzenecarbothioamide (PubChem CID 103567292) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-5-methoxybenzenecarbothioamide.
| Compound Name | 3-(3,3-dimethylbutoxy)-5-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 103567292 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-(3,3-dimethylbutoxy)-5-methoxybenzenecarbothioamide |
| SMILES | COc1cc(OCCC(C)(C)C)cc(C(N)=S)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-14(2,3)5-6-17-12-8-10(13(15)18)7-11(9-12)16-4/h7-9H,5-6H2,1-4H3,(H2,15,18) |
| InChIKey | JKEOGGPQSZWRER-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|