C14H20N2O3 — CID 103567543
3-(cyclopentylmethoxy)-N'-hydroxy-5-methoxybenzenecarboximidamide (PubChem CID 103567543) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(cyclopentylmethoxy)-N'-hydroxy-5-methoxybenzenecarboximidamide.
| Compound Name | 3-(cyclopentylmethoxy)-N'-hydroxy-5-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 103567543 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(cyclopentylmethoxy)-N'-hydroxy-5-methoxybenzenecarboximidamide |
| SMILES | COc1cc(OCC2CCCC2)cc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-18-12-6-11(14(15)16-17)7-13(8-12)19-9-10-4-2-3-5-10/h6-8,10,17H,2-5,9H2,1H3,(H2,15,16) |
| InChIKey | JLCDSTBIISRNII-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|