C14H20N2O2 — CID 77068953
4-(cyclobutylmethoxy)-N'-hydroxy-3,5-dimethylbenzenecarboximidamide (PubChem CID 77068953) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-(cyclobutylmethoxy)-N'-hydroxy-3,5-dimethylbenzenecarboximidamide.
| Compound Name | 4-(cyclobutylmethoxy)-N'-hydroxy-3,5-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 77068953 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-(cyclobutylmethoxy)-N'-hydroxy-3,5-dimethylbenzenecarboximidamide |
| SMILES | Cc1cc(C(N)=NO)cc(C)c1OCC1CCC1 |
| InChI | InChI=1S/C14H20N2O2/c1-9-6-12(14(15)16-17)7-10(2)13(9)18-8-11-4-3-5-11/h6-7,11,17H,3-5,8H2,1-2H3,(H2,15,16) |
| InChIKey | WMWUKGHCUZNKFB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|