C14H17NO5 — CID 103568039
3-methoxy-5-[2-oxo-2-(oxolan-3-yl)ethoxy]benzamide (PubChem CID 103568039) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-methoxy-5-[2-oxo-2-(oxolan-3-yl)ethoxy]benzamide.
| Compound Name | 3-methoxy-5-[2-oxo-2-(oxolan-3-yl)ethoxy]benzamide |
|---|---|
| PubChem CID | 103568039 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-methoxy-5-[2-oxo-2-(oxolan-3-yl)ethoxy]benzamide |
| SMILES | COc1cc(OCC(=O)C2CCOC2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C14H17NO5/c1-18-11-4-10(14(15)17)5-12(6-11)20-8-13(16)9-2-3-19-7-9/h4-6,9H,2-3,7-8H2,1H3,(H2,15,17) |
| InChIKey | DQVSZCRCEDXLBJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |