C11H21N3O2 — CID 103569367
N-[(1-ethylpyrazol-4-yl)methyl]-1,1-dimethoxypropan-2-amine (PubChem CID 103569367) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-1,1-dimethoxypropan-2-amine.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-1,1-dimethoxypropan-2-amine |
|---|---|
| PubChem CID | 103569367 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-1,1-dimethoxypropan-2-amine |
| SMILES | CCn1cc(CNC(C)C(OC)OC)cn1 |
| InChI | InChI=1S/C11H21N3O2/c1-5-14-8-10(7-13-14)6-12-9(2)11(15-3)16-4/h7-9,11-12H,5-6H2,1-4H3 |
| InChIKey | NMFMJMWXHWCJTE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|