C11H18F3N3O2 — CID 162690406
N-[(1-ethylpyrazol-4-yl)methyl]-1,1,1-trifluoro-3,3-dimethoxypropan-2-amine (PubChem CID 162690406) has the molecular formula C11H18F3N3O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-1,1,1-trifluoro-3,3-dimethoxypropan-2-amine.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-1,1,1-trifluoro-3,3-dimethoxypropan-2-amine |
|---|---|
| PubChem CID | 162690406 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-1,1,1-trifluoro-3,3-dimethoxypropan-2-amine |
| SMILES | CCn1cc(CNC(C(OC)OC)C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H18F3N3O2/c1-4-17-7-8(6-16-17)5-15-9(11(12,13)14)10(18-2)19-3/h6-7,9-10,15H,4-5H2,1-3H3 |
| InChIKey | AARSLUHRTJPDFB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|