C8H12N4O — CID 103570871
4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 103570871) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 103570871 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCn1cc(C2COC(N)=N2)cn1 |
| InChI | InChI=1S/C8H12N4O/c1-2-12-4-6(3-10-12)7-5-13-8(9)11-7/h3-4,7H,2,5H2,1H3,(H2,9,11) |
| InChIKey | JECIUJSYTULVKS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |