About 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine
4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 103570871) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 103570871 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCn1cc(C2COC(N)=N2)cn1 |
| InChI | InChI=1S/C8H12N4O/c1-2-12-4-6(3-10-12)7-5-13-8(9)11-7/h3-4,7H,2,5H2,1H3,(H2,9,11) |
| InChIKey | JECIUJSYTULVKS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine (CID 103570871) is 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine is CCn1cc(C2COC(N)=N2)cn1.
What is the InChIKey of 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is JECIUJSYTULVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-2-12-4-6(3-10-12)7-5-13-8(9)11-7/h3-4,7H,2,5H2,1H3,(H2,9,11).
What are the key properties of 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine?
4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 180.21 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethylpyrazol-4-yl)-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 103570871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).