C11H20N4O — CID 103571495
2-methyl-2-[(1-propylpyrazol-4-yl)methylamino]propanamide (PubChem CID 103571495) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-methyl-2-[(1-propylpyrazol-4-yl)methylamino]propanamide.
| Compound Name | 2-methyl-2-[(1-propylpyrazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 103571495 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-methyl-2-[(1-propylpyrazol-4-yl)methylamino]propanamide |
| SMILES | CCCn1cc(CNC(C)(C)C(N)=O)cn1 |
| InChI | InChI=1S/C11H20N4O/c1-4-5-15-8-9(7-14-15)6-13-11(2,3)10(12)16/h7-8,13H,4-6H2,1-3H3,(H2,12,16) |
| InChIKey | QYQHYBRAFVEJHZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |