C10H19N5O — CID 103571628
2-[(1-propylpyrazol-4-yl)methylamino]ethylurea (PubChem CID 103571628) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-[(1-propylpyrazol-4-yl)methylamino]ethylurea.
| Compound Name | 2-[(1-propylpyrazol-4-yl)methylamino]ethylurea |
|---|---|
| PubChem CID | 103571628 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-[(1-propylpyrazol-4-yl)methylamino]ethylurea |
| SMILES | CCCn1cc(CNCCNC(N)=O)cn1 |
| InChI | InChI=1S/C10H19N5O/c1-2-5-15-8-9(7-14-15)6-12-3-4-13-10(11)16/h7-8,12H,2-6H2,1H3,(H3,11,13,16) |
| InChIKey | WBHGZSMIPSUXQN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|