C10H17N7 — CID 103571505
N-[(1-propylpyrazol-4-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine (PubChem CID 103571505) has the molecular formula C10H17N7 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[(1-propylpyrazol-4-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine.
| Compound Name | N-[(1-propylpyrazol-4-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103571505 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N-[(1-propylpyrazol-4-yl)methyl]-1-(2H-tetrazol-5-yl)ethanamine |
| SMILES | CCCn1cc(CNC(C)c2nn[nH]n2)cn1 |
| InChI | InChI=1S/C10H17N7/c1-3-4-17-7-9(6-12-17)5-11-8(2)10-13-15-16-14-10/h6-8,11H,3-5H2,1-2H3,(H,13,14,15,16) |
| InChIKey | POGYTHMBMBJBKB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |