C13H16Cl2N4 — CID 103572455
4,6-dichloro-5-propan-2-yl-2-(1-propylpyrazol-4-yl)pyrimidine (PubChem CID 103572455) has the molecular formula C13H16Cl2N4 and a molecular weight of 299.21 g/mol. Its IUPAC name is 4,6-dichloro-5-propan-2-yl-2-(1-propylpyrazol-4-yl)pyrimidine.
| Compound Name | 4,6-dichloro-5-propan-2-yl-2-(1-propylpyrazol-4-yl)pyrimidine |
|---|---|
| PubChem CID | 103572455 |
| Molecular Formula | C13H16Cl2N4 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4,6-dichloro-5-propan-2-yl-2-(1-propylpyrazol-4-yl)pyrimidine |
| SMILES | CCCn1cc(-c2nc(Cl)c(C(C)C)c(Cl)n2)cn1 |
| InChI | InChI=1S/C13H16Cl2N4/c1-4-5-19-7-9(6-16-19)13-17-11(14)10(8(2)3)12(15)18-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | XODRGBQMKOETKC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |