C5H11NaO5S — CID 103573923
sodium 2-hydroxy-4-methoxybutane-2-sulfonate (PubChem CID 103573923) has the molecular formula C5H11NaO5S and a molecular weight of 206.19 g/mol. Its IUPAC name is sodium 2-hydroxy-4-methoxybutane-2-sulfonate.
| Compound Name | sodium 2-hydroxy-4-methoxybutane-2-sulfonate |
|---|---|
| PubChem CID | 103573923 |
| Molecular Formula | C5H11NaO5S |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | sodium 2-hydroxy-4-methoxybutane-2-sulfonate |
| SMILES | COCCC(C)(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H12O5S.Na/c1-5(6,3-4-10-2)11(7,8)9;/h6H,3-4H2,1-2H3,(H,7,8,9);/q;+1/p-1 |
| InChIKey | WLPIBYKUTGNJSW-UHFFFAOYSA-M |
| XLogP | -3.72 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|