C12H24O4 — CID 66337989
tert-butyl 3-hydroxy-5-methoxy-2,3-dimethylpentanoate (PubChem CID 66337989) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-5-methoxy-2,3-dimethylpentanoate.
| Compound Name | tert-butyl 3-hydroxy-5-methoxy-2,3-dimethylpentanoate |
|---|---|
| PubChem CID | 66337989 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | tert-butyl 3-hydroxy-5-methoxy-2,3-dimethylpentanoate |
| SMILES | COCCC(C)(O)C(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24O4/c1-9(10(13)16-11(2,3)4)12(5,14)7-8-15-6/h9,14H,7-8H2,1-6H3 |
| InChIKey | WKRIMFGJQXYAAH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |