C7H5ClFNaO4S — CID 103573975
sodium (3-chloro-5-fluorophenyl)-hydroxymethanesulfonate (PubChem CID 103573975) has the molecular formula C7H5ClFNaO4S and a molecular weight of 262.62 g/mol. Its IUPAC name is sodium (3-chloro-5-fluorophenyl)-hydroxymethanesulfonate.
| Compound Name | sodium (3-chloro-5-fluorophenyl)-hydroxymethanesulfonate |
|---|---|
| PubChem CID | 103573975 |
| Molecular Formula | C7H5ClFNaO4S |
| Molecular Weight | 262.62 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | sodium (3-chloro-5-fluorophenyl)-hydroxymethanesulfonate |
| SMILES | O=S(=O)([O-])C(O)c1cc(F)cc(Cl)c1.[Na+] |
| InChI | InChI=1S/C7H6ClFO4S.Na/c8-5-1-4(2-6(9)3-5)7(10)14(11,12)13;/h1-3,7,10H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | NZTPPJXLWRXQKT-UHFFFAOYSA-M |
| XLogP | -1.98 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.62 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|