C14H14Cl2O3 — CID 103574833
1-[(2,6-dichlorophenyl)methyl]-2-oxocyclohexane-1-carboxylic acid (PubChem CID 103574833) has the molecular formula C14H14Cl2O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2-oxocyclohexane-1-carboxylic acid.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 103574833 |
| Molecular Formula | C14H14Cl2O3 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2-oxocyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2c(Cl)cccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C14H14Cl2O3/c15-10-4-3-5-11(16)9(10)8-14(13(18)19)7-2-1-6-12(14)17/h3-5H,1-2,6-8H2,(H,18,19) |
| InChIKey | NJVBNFXPXWGEMT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|