C11H20N4 — CID 103575226
1-[(2-ethylpyrazol-3-yl)methyl]-4-methylpyrrolidin-3-amine (PubChem CID 103575226) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-[(2-ethylpyrazol-3-yl)methyl]-4-methylpyrrolidin-3-amine.
| Compound Name | 1-[(2-ethylpyrazol-3-yl)methyl]-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103575226 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-[(2-ethylpyrazol-3-yl)methyl]-4-methylpyrrolidin-3-amine |
| SMILES | CCn1nccc1CN1CC(C)C(N)C1 |
| InChI | InChI=1S/C11H20N4/c1-3-15-10(4-5-13-15)7-14-6-9(2)11(12)8-14/h4-5,9,11H,3,6-8,12H2,1-2H3 |
| InChIKey | GDNBOWCMEZUAFC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |