C15H30N2O4 — CID 10357576
1-[(E)-[2,2-bis(hydroxymethyl)cyclohexylidene]amino]oxy-3-(tert-butylamino)propan-2-ol (PubChem CID 10357576) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[(E)-[2,2-bis(hydroxymethyl)cyclohexylidene]amino]oxy-3-(tert-butylamino)propan-2-ol.
| Compound Name | 1-[(E)-[2,2-bis(hydroxymethyl)cyclohexylidene]amino]oxy-3-(tert-butylamino)propan-2-ol |
|---|---|
| PubChem CID | 10357576 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-[(E)-[2,2-bis(hydroxymethyl)cyclohexylidene]amino]oxy-3-(tert-butylamino)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)CO/N=C1\CCCCC1(CO)CO |
| InChI | InChI=1S/C15H30N2O4/c1-14(2,3)16-8-12(20)9-21-17-13-6-4-5-7-15(13,10-18)11-19/h12,16,18-20H,4-11H2,1-3H3/b17-13+ |
| InChIKey | WUALFUBBNRLMEI-GHRIWEEISA-N |
| XLogP | 0.65 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|