C10H14FN3 — CID 103577365
1-(3-fluoro-2-pyridinyl)-4-methylpyrrolidin-3-amine (PubChem CID 103577365) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyridinyl)-4-methylpyrrolidin-3-amine.
| Compound Name | 1-(3-fluoro-2-pyridinyl)-4-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103577365 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 1-(3-fluoro-2-pyridinyl)-4-methylpyrrolidin-3-amine |
| SMILES | CC1CN(c2ncccc2F)CC1N |
| InChI | InChI=1S/C10H14FN3/c1-7-5-14(6-9(7)12)10-8(11)3-2-4-13-10/h2-4,7,9H,5-6,12H2,1H3 |
| InChIKey | FPRXSOFDDPSJKK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |