C17H24O5 — CID 10357921
(1S,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-3,10-dien-2-one (PubChem CID 10357921) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1S,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-3,10-dien-2-one.
| Compound Name | (1S,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-3,10-dien-2-one |
|---|---|
| PubChem CID | 10357921 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1S,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-3,10-dien-2-one |
| SMILES | COCOCC1=C(COCOC)[C@]23CCC[C@]12CC=CC3=O |
| InChI | InChI=1S/C17H24O5/c1-19-11-21-9-13-14(10-22-12-20-2)17-8-4-7-16(13,17)6-3-5-15(17)18/h3,5H,4,6-12H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | WOHPJXFEPBEGKW-SJORKVTESA-N |
| XLogP | 2.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|