C23H34O4 — CID 159817430
(3aS,6R)-3a-[(3R,4R)-4-ethenyl-3-(methoxymethoxy)-4-methyl-6-oxohept-1-en-2-yl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one (PubChem CID 159817430) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (3aS,6R)-3a-[(3R,4R)-4-ethenyl-3-(methoxymethoxy)-4-methyl-6-oxohept-1-en-2-yl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one.
| Compound Name | (3aS,6R)-3a-[(3R,4R)-4-ethenyl-3-(methoxymethoxy)-4-methyl-6-oxohept-1-en-2-yl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 159817430 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (3aS,6R)-3a-[(3R,4R)-4-ethenyl-3-(methoxymethoxy)-4-methyl-6-oxohept-1-en-2-yl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
| SMILES | C=C[C@@](C)(CC(C)=O)[C@@H](OCOC)C(=C)[C@]12CCC(=O)C1=C(C)[C@H](C)CC2 |
| InChI | InChI=1S/C23H34O4/c1-8-22(6,13-16(3)24)21(27-14-26-7)18(5)23-11-9-15(2)17(4)20(23)19(25)10-12-23/h8,15,21H,1,5,9-14H2,2-4,6-7H3/t15-,21+,22+,23+/m1/s1 |
| InChIKey | TWCKNTHBXIDXEB-RVMZHNTDSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|