C12H18O3 — CID 74818074
1-(methoxymethoxy)-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 74818074) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(methoxymethoxy)-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | 1-(methoxymethoxy)-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 74818074 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(methoxymethoxy)-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | COCOC1CCC2=CC(=O)CCC21C |
| InChI | InChI=1S/C12H18O3/c1-12-6-5-10(13)7-9(12)3-4-11(12)15-8-14-2/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | RJTHXABUCVFNNT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|