About 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one
1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 13033864) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one.
Analyze 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one?
The IUPAC name of 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one (CID 13033864) is 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one.
What is the SMILES notation for 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one?
The canonical SMILES for 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one is CC12CCC(=O)C=C1CCC2O.
What is the InChIKey of 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one?
The InChIKey is VQOIXUDPFMOECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-10-5-4-8(11)6-7(10)2-3-9(10)12/h6,9,12H,2-5H2,1H3.
What are the key properties of 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one?
1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one has a molecular weight of 166.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one is sourced from PubChem (CID 13033864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).