C18H28O2S — CID 10357950
2,2-dimethyl-6-phenylsulfanyl-5-propan-2-yloxyheptan-3-one (PubChem CID 10357950) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 2,2-dimethyl-6-phenylsulfanyl-5-propan-2-yloxyheptan-3-one.
| Compound Name | 2,2-dimethyl-6-phenylsulfanyl-5-propan-2-yloxyheptan-3-one |
|---|---|
| PubChem CID | 10357950 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,2-dimethyl-6-phenylsulfanyl-5-propan-2-yloxyheptan-3-one |
| SMILES | CC(C)OC(CC(=O)C(C)(C)C)C(C)Sc1ccccc1 |
| InChI | InChI=1S/C18H28O2S/c1-13(2)20-16(12-17(19)18(4,5)6)14(3)21-15-10-8-7-9-11-15/h7-11,13-14,16H,12H2,1-6H3 |
| InChIKey | NZKHMZUALGNJQO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |