C11H21NO — CID 103581292
2,3-dimethyl-N-(3-methylbut-3-enyl)oxolan-3-amine (PubChem CID 103581292) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2,3-dimethyl-N-(3-methylbut-3-enyl)oxolan-3-amine.
| Compound Name | 2,3-dimethyl-N-(3-methylbut-3-enyl)oxolan-3-amine |
|---|---|
| PubChem CID | 103581292 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2,3-dimethyl-N-(3-methylbut-3-enyl)oxolan-3-amine |
| SMILES | C=C(C)CCNC1(C)CCOC1C |
| InChI | InChI=1S/C11H21NO/c1-9(2)5-7-12-11(4)6-8-13-10(11)3/h10,12H,1,5-8H2,2-4H3 |
| InChIKey | IPGQDAWTLWEWHG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|