C13H19BrClN3O — CID 103584045
N-[[4-(5-bromo-3-chloro-2-pyridinyl)morpholin-3-yl]methyl]propan-1-amine (PubChem CID 103584045) has the molecular formula C13H19BrClN3O and a molecular weight of 348.67 g/mol. Its IUPAC name is N-[[4-(5-bromo-3-chloro-2-pyridinyl)morpholin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-(5-bromo-3-chloro-2-pyridinyl)morpholin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103584045 |
| Molecular Formula | C13H19BrClN3O |
| Molecular Weight | 348.67 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[[4-(5-bromo-3-chloro-2-pyridinyl)morpholin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1COCCN1c1ncc(Br)cc1Cl |
| InChI | InChI=1S/C13H19BrClN3O/c1-2-3-16-8-11-9-19-5-4-18(11)13-12(15)6-10(14)7-17-13/h6-7,11,16H,2-5,8-9H2,1H3 |
| InChIKey | NXKBJXVFXRUARE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|