C13H17ClF3N3O — CID 83106018
N-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]morpholin-3-yl]methyl]ethanamine (PubChem CID 83106018) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is N-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]morpholin-3-yl]methyl]ethanamine.
| Compound Name | N-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]morpholin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 83106018 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]morpholin-3-yl]methyl]ethanamine |
| SMILES | CCNCC1COCCN1c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H17ClF3N3O/c1-2-18-7-10-8-21-4-3-20(10)12-11(14)5-9(6-19-12)13(15,16)17/h5-6,10,18H,2-4,7-8H2,1H3 |
| InChIKey | UWHXRIHKEFWLCH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |